C12H9Cl2N3OS — CID 115331203
3,5-dichloro-4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)aniline (PubChem CID 115331203) has the molecular formula C12H9Cl2N3OS and a molecular weight of 314.20 g/mol. Its IUPAC name is 3,5-dichloro-4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)aniline.
| Compound Name | 3,5-dichloro-4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)aniline |
|---|---|
| PubChem CID | 115331203 |
| Molecular Formula | C12H9Cl2N3OS |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 3,5-dichloro-4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)aniline |
| SMILES | Nc1cc(Cl)c(OCc2cn3ccsc3n2)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2N3OS/c13-9-3-7(15)4-10(14)11(9)18-6-8-5-17-1-2-19-12(17)16-8/h1-5H,6,15H2 |
| InChIKey | DJECUGXEPSCGIT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|