C13H11N3O3S — CID 107076961
2-amino-5-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzoic acid (PubChem CID 107076961) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-amino-5-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzoic acid.
| Compound Name | 2-amino-5-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 107076961 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-amino-5-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)benzoic acid |
| SMILES | Nc1ccc(OCc2cn3ccsc3n2)cc1C(=O)O |
| InChI | InChI=1S/C13H11N3O3S/c14-11-2-1-9(5-10(11)12(17)18)19-7-8-6-16-3-4-20-13(16)15-8/h1-6H,7,14H2,(H,17,18) |
| InChIKey | ICDDJKDDJOZABG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|