C14H14N2O2S — CID 115332160
1-[4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]ethanol (PubChem CID 115332160) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-[4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]ethanol.
| Compound Name | 1-[4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 115332160 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-[4-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)phenyl]ethanol |
| SMILES | CC(O)c1ccc(OCc2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C14H14N2O2S/c1-10(17)11-2-4-13(5-3-11)18-9-12-8-16-6-7-19-14(16)15-12/h2-8,10,17H,9H2,1H3 |
| InChIKey | LUIFOUFQXCYMGD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |