C14H13N3O3S — CID 104784225
imidazo[2,1-b][1,3]thiazol-6-ylmethyl 4-amino-3-methoxybenzoate (PubChem CID 104784225) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazol-6-ylmethyl 4-amino-3-methoxybenzoate.
| Compound Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl 4-amino-3-methoxybenzoate |
|---|---|
| PubChem CID | 104784225 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl 4-amino-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cn3ccsc3n2)ccc1N |
| InChI | InChI=1S/C14H13N3O3S/c1-19-12-6-9(2-3-11(12)15)13(18)20-8-10-7-17-4-5-21-14(17)16-10/h2-7H,8,15H2,1H3 |
| InChIKey | OYQRMSKUXGAOAU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|