C14H13N3O2S2 — CID 103567303
3-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-methoxybenzenecarbothioamide (PubChem CID 103567303) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-methoxybenzenecarbothioamide.
| Compound Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 103567303 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-5-methoxybenzenecarbothioamide |
| SMILES | COc1cc(OCc2cn3ccsc3n2)cc(C(N)=S)c1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-18-11-4-9(13(15)20)5-12(6-11)19-8-10-7-17-2-3-21-14(17)16-10/h2-7H,8H2,1H3,(H2,15,20) |
| InChIKey | VUNGIBYYWOZWJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|