C19H14ClN3O2S — CID 40723393
2-(3-chlorophenoxy)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)acetamide (PubChem CID 40723393) has the molecular formula C19H14ClN3O2S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)acetamide |
|---|---|
| PubChem CID | 40723393 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)Nc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C19H14ClN3O2S/c20-14-2-1-3-16(10-14)25-12-18(24)21-15-6-4-13(5-7-15)17-11-23-8-9-26-19(23)22-17/h1-11H,12H2,(H,21,24) |
| InChIKey | LWFCRQIVIDCYCI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |