C20H15ClNO4S- — CID 59334768
4-[4-[[2-(3-chlorophenoxy)acetyl]amino]phenyl]benzenesulfinate (PubChem CID 59334768) has the molecular formula C20H15ClNO4S- and a molecular weight of 400.86 g/mol. Its IUPAC name is 4-[4-[[2-(3-chlorophenoxy)acetyl]amino]phenyl]benzenesulfinate.
| Compound Name | 4-[4-[[2-(3-chlorophenoxy)acetyl]amino]phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 59334768 |
| Molecular Formula | C20H15ClNO4S- |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-[4-[[2-(3-chlorophenoxy)acetyl]amino]phenyl]benzenesulfinate |
| SMILES | O=C(COc1cccc(Cl)c1)Nc1ccc(-c2ccc(S(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H16ClNO4S/c21-16-2-1-3-18(12-16)26-13-20(23)22-17-8-4-14(5-9-17)15-6-10-19(11-7-15)27(24)25/h1-12H,13H2,(H,22,23)(H,24,25)/p-1 |
| InChIKey | OHHQAGNFAYHGLW-UHFFFAOYSA-M |
| XLogP | 4.26 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|