C12H15NOS2 — CID 112795792
3-(butylsulfanylmethyl)-5-thiophen-2-yl-1,2-oxazole (PubChem CID 112795792) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-(butylsulfanylmethyl)-5-thiophen-2-yl-1,2-oxazole.
| Compound Name | 3-(butylsulfanylmethyl)-5-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 112795792 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-(butylsulfanylmethyl)-5-thiophen-2-yl-1,2-oxazole |
| SMILES | CCCCSCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C12H15NOS2/c1-2-3-6-15-9-10-8-11(14-13-10)12-5-4-7-16-12/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | HDZGGZSVRMIWNP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|