C19H18N2O4S2 — CID 86960884
[4-(ethylcarbamoyl)phenyl] 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]acetate (PubChem CID 86960884) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)phenyl] 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]acetate.
| Compound Name | [4-(ethylcarbamoyl)phenyl] 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 86960884 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [4-(ethylcarbamoyl)phenyl] 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylsulfanyl]acetate |
| SMILES | CCNC(=O)c1ccc(OC(=O)CSCc2cc(-c3cccs3)on2)cc1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-2-20-19(23)13-5-7-15(8-6-13)24-18(22)12-26-11-14-10-16(25-21-14)17-4-3-9-27-17/h3-10H,2,11-12H2,1H3,(H,20,23) |
| InChIKey | LHNCBSHMGUUBLR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|