C11H11NO2S — CID 102543890
[1-(5-thiophen-2-yl-1,2-oxazol-3-yl)cyclopropyl]methanol (PubChem CID 102543890) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is [1-(5-thiophen-2-yl-1,2-oxazol-3-yl)cyclopropyl]methanol.
| Compound Name | [1-(5-thiophen-2-yl-1,2-oxazol-3-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 102543890 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [1-(5-thiophen-2-yl-1,2-oxazol-3-yl)cyclopropyl]methanol |
| SMILES | OCC1(c2cc(-c3cccs3)on2)CC1 |
| InChI | InChI=1S/C11H11NO2S/c13-7-11(3-4-11)10-6-8(14-12-10)9-2-1-5-15-9/h1-2,5-6,13H,3-4,7H2 |
| InChIKey | CPOWFQVWGUDPTC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |