C9H9NO2S — CID 44603815
1-(5-thiophen-2-yl-1,2-oxazol-3-yl)ethanol (PubChem CID 44603815) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1,2-oxazol-3-yl)ethanol.
| Compound Name | 1-(5-thiophen-2-yl-1,2-oxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 44603815 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 1-(5-thiophen-2-yl-1,2-oxazol-3-yl)ethanol |
| SMILES | CC(O)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C9H9NO2S/c1-6(11)7-5-8(12-10-7)9-3-2-4-13-9/h2-6,11H,1H3 |
| InChIKey | YXEFWZOCGPBALL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |