C10H11NO2S — CID 69240115
1-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethanol (PubChem CID 69240115) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethanol.
| Compound Name | 1-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethanol |
|---|---|
| PubChem CID | 69240115 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 1-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)ethanol |
| SMILES | Cc1oc(-c2cccs2)nc1C(C)O |
| InChI | InChI=1S/C10H11NO2S/c1-6(12)9-7(2)13-10(11-9)8-4-3-5-14-8/h3-6,12H,1-2H3 |
| InChIKey | NHJTYGLBHYIMJD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |