C14H14FNO2 — CID 102543907
[1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]cyclobutyl]methanol (PubChem CID 102543907) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is [1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]cyclobutyl]methanol.
| Compound Name | [1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 102543907 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | [1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]cyclobutyl]methanol |
| SMILES | OCC1(c2cc(-c3ccc(F)cc3)on2)CCC1 |
| InChI | InChI=1S/C14H14FNO2/c15-11-4-2-10(3-5-11)12-8-13(16-18-12)14(9-17)6-1-7-14/h2-5,8,17H,1,6-7,9H2 |
| InChIKey | SEELLIYRKIXROB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |