C11H11NOS2 — CID 116966897
[1-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropyl]methanol (PubChem CID 116966897) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is [1-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropyl]methanol.
| Compound Name | [1-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 116966897 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | [1-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclopropyl]methanol |
| SMILES | OCC1(c2nc(-c3cccs3)cs2)CC1 |
| InChI | InChI=1S/C11H11NOS2/c13-7-11(3-4-11)10-12-8(6-15-10)9-2-1-5-14-9/h1-2,5-6,13H,3-4,7H2 |
| InChIKey | YORIWAOTEMJCHH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |