About [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol
[1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol (PubChem CID 60684977) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol |
| PubChem CID | 60684977 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1Cc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C14H18N2O2S/c17-10-12-4-1-2-6-16(12)9-11-8-13(18-15-11)14-5-3-7-19-14/h3,5,7-8,12,17H,1-2,4,6,9-10H2 |
| InChIKey | RGNRCTAMDRTCMR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol?
The IUPAC name of [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol (CID 60684977) is [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol.
What is the SMILES notation for [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol?
The canonical SMILES for [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol is OCC1CCCCN1Cc1cc(-c2cccs2)on1.
What is the InChIKey of [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol?
The InChIKey is RGNRCTAMDRTCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S/c17-10-12-4-1-2-6-16(12)9-11-8-13(18-15-11)14-5-3-7-19-14/h3,5,7-8,12,17H,1-2,4,6,9-10H2.
What are the key properties of [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol?
[1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol has a molecular weight of 278.38 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]piperidin-2-yl]methanol is sourced from PubChem (CID 60684977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).