C20H29N3O3S — CID 92722011
N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide (PubChem CID 92722011) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide.
| Compound Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 92722011 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)COCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C20H29N3O3S/c1-2-17-7-3-4-10-23(17)11-6-9-21-20(24)15-25-14-16-13-18(26-22-16)19-8-5-12-27-19/h5,8,12-13,17H,2-4,6-7,9-11,14-15H2,1H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | BMIRNQGNIYVWKN-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|