C12H9N3O4S — CID 17407840
1-methyl-3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 17407840) has the molecular formula C12H9N3O4S and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-methyl-3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-methyl-3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 17407840 |
| Molecular Formula | C12H9N3O4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-methyl-3-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(Cc2cc(-c3cccs3)on2)C1=O |
| InChI | InChI=1S/C12H9N3O4S/c1-14-10(16)11(17)15(12(14)18)6-7-5-8(19-13-7)9-3-2-4-20-9/h2-5H,6H2,1H3 |
| InChIKey | GSULZJGTRKXKNR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|