C18H13N3O4S — CID 17407874
1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 17407874) has the molecular formula C18H13N3O4S and a molecular weight of 367.39 g/mol. Its IUPAC name is 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 17407874 |
| Molecular Formula | C18H13N3O4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(Cc2cccs2)C(=O)N1Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C18H13N3O4S/c22-16-17(23)21(11-14-7-4-8-26-14)18(24)20(16)10-13-9-15(25-19-13)12-5-2-1-3-6-12/h1-9H,10-11H2 |
| InChIKey | IQYBBURKQXFYBA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|