C16H14N2O4S — CID 47077577
methyl (2E)-2-[4-oxo-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 47077577) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is methyl (2E)-2-[4-oxo-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-[4-oxo-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 47077577 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl (2E)-2-[4-oxo-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1/SCC(=O)N1Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H14N2O4S/c1-21-16(20)8-15-18(14(19)10-23-15)9-12-7-13(22-17-12)11-5-3-2-4-6-11/h2-8H,9-10H2,1H3/b15-8+ |
| InChIKey | RXTJYTNJERGYJB-OVCLIPMQSA-N |
| XLogP | 2.43 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|