C26H23N5O3S — CID 24510574
1-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 24510574) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is 1-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 24510574 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 1-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccccc1)CN1C(=O)C(=O)N(Cc2cccs2)C1=O |
| InChI | InChI=1S/C26H23N5O3S/c1-28(18-30-25(33)24(32)29(26(30)34)17-22-13-8-14-35-22)15-20-16-31(21-11-6-3-7-12-21)27-23(20)19-9-4-2-5-10-19/h2-14,16H,15,17-18H2,1H3 |
| InChIKey | ONBFEEZGGDNYMP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|