C27H31N5O2 — CID 30014671
(5R,6S)-3-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 30014671) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (5R,6S)-3-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-3-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 30014671 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (5R,6S)-3-[[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CN(C)Cc1cn(-c3ccccc3)nc1-c1ccccc1)C2=O |
| InChI | InChI=1S/C27H31N5O2/c1-20-11-9-10-16-27(20)25(33)31(26(34)28-27)19-30(2)17-22-18-32(23-14-7-4-8-15-23)29-24(22)21-12-5-3-6-13-21/h3-8,12-15,18,20H,9-11,16-17,19H2,1-2H3,(H,28,34)/t20-,27+/m0/s1 |
| InChIKey | KRPAAENKJLYTAR-CCLHPLFOSA-N |
| XLogP | 4.43 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|