C18H21N5O2 — CID 51951203
(5R,6R)-6-methyl-3-[(2-phenyltriazol-4-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 51951203) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (5R,6R)-6-methyl-3-[(2-phenyltriazol-4-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-6-methyl-3-[(2-phenyltriazol-4-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 51951203 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (5R,6R)-6-methyl-3-[(2-phenyltriazol-4-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(Cc1cnn(-c3ccccc3)n1)C2=O |
| InChI | InChI=1S/C18H21N5O2/c1-13-7-5-6-10-18(13)16(24)22(17(25)20-18)12-14-11-19-23(21-14)15-8-3-2-4-9-15/h2-4,8-9,11,13H,5-7,10,12H2,1H3,(H,20,25)/t13-,18-/m1/s1 |
| InChIKey | UPWRGKRBCHXCOI-FZKQIMNGSA-N |
| XLogP | 2.27 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|