C17H19N3OS — CID 162659627
8-benzyl-3-thiophen-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene (PubChem CID 162659627) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 8-benzyl-3-thiophen-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene.
| Compound Name | 8-benzyl-3-thiophen-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 162659627 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 8-benzyl-3-thiophen-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene |
| SMILES | c1ccc(CN2CCC3(CC2)N=C(c2cccs2)NO3)cc1 |
| InChI | InChI=1S/C17H19N3OS/c1-2-5-14(6-3-1)13-20-10-8-17(9-11-20)18-16(19-21-17)15-7-4-12-22-15/h1-7,12H,8-11,13H2,(H,18,19) |
| InChIKey | RQTUOUMTHPFJMV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |