C19H20FN3O — CID 162674490
8-benzyl-3-(4-fluorophenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene (PubChem CID 162674490) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is 8-benzyl-3-(4-fluorophenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene.
| Compound Name | 8-benzyl-3-(4-fluorophenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 162674490 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 8-benzyl-3-(4-fluorophenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-3-ene |
| SMILES | Fc1ccc(C2=NC3(CCN(Cc4ccccc4)CC3)ON2)cc1 |
| InChI | InChI=1S/C19H20FN3O/c20-17-8-6-16(7-9-17)18-21-19(24-22-18)10-12-23(13-11-19)14-15-4-2-1-3-5-15/h1-9H,10-14H2,(H,21,22) |
| InChIKey | GNWPGNHCPHHUNU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |