C24H24FNOS — CID 144882442
(3R)-1-benzyl-3-(4-fluorophenyl)sulfinyl-3-(4-methylphenyl)pyrrolidine (PubChem CID 144882442) has the molecular formula C24H24FNOS and a molecular weight of 393.53 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(4-fluorophenyl)sulfinyl-3-(4-methylphenyl)pyrrolidine.
| Compound Name | (3R)-1-benzyl-3-(4-fluorophenyl)sulfinyl-3-(4-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 144882442 |
| Molecular Formula | C24H24FNOS |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (3R)-1-benzyl-3-(4-fluorophenyl)sulfinyl-3-(4-methylphenyl)pyrrolidine |
| SMILES | Cc1ccc([C@]2(S(=O)c3ccc(F)cc3)CCN(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H24FNOS/c1-19-7-9-21(10-8-19)24(28(27)23-13-11-22(25)12-14-23)15-16-26(18-24)17-20-5-3-2-4-6-20/h2-14H,15-18H2,1H3/t24-,28?/m0/s1 |
| InChIKey | UZIWCWJFZUCRPH-ZZDYIDRTSA-N |
| XLogP | 5.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |