C31H29F2N3O — CID 90830849
4-(4-fluorophenyl)-1-[[4-(4-fluorophenyl)phenyl]methyl]-N'-phenylpiperidine-4-carbohydrazide (PubChem CID 90830849) has the molecular formula C31H29F2N3O and a molecular weight of 497.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[[4-(4-fluorophenyl)phenyl]methyl]-N'-phenylpiperidine-4-carbohydrazide.
| Compound Name | 4-(4-fluorophenyl)-1-[[4-(4-fluorophenyl)phenyl]methyl]-N'-phenylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 90830849 |
| Molecular Formula | C31H29F2N3O |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[[4-(4-fluorophenyl)phenyl]methyl]-N'-phenylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)C1(c2ccc(F)cc2)CCN(Cc2ccc(-c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H29F2N3O/c32-27-14-10-25(11-15-27)24-8-6-23(7-9-24)22-36-20-18-31(19-21-36,26-12-16-28(33)17-13-26)30(37)35-34-29-4-2-1-3-5-29/h1-17,34H,18-22H2,(H,35,37) |
| InChIKey | GBKIOCFVBRQECB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|