1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride

C19H19Cl2NO — CID 87592673

IUPAC1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1
InChIInChI=1S/C19H19Cl2NO/c20-17-8-6-16(7-9-17)19(18(21)23)10-12-22(13-11-19)14-15-4-2-1-3-5-15/h1-9H,10-14H2
InChIKeyUUOARXCPUKAUIJ-UHFFFAOYSA-N
MW348.27 g/mol
LogP4.64
Rot. Bonds4

About 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride

1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride (PubChem CID 87592673) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride.

Molecular Properties

Compound Name1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride
PubChem CID87592673
Molecular FormulaC19H19Cl2NO
Molecular Weight348.27 g/mol
Exact Mass347.08
IUPAC Name1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride
SMILESO=C(Cl)C1(c2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1
InChIInChI=1S/C19H19Cl2NO/c20-17-8-6-16(7-9-17)19(18(21)23)10-12-22(13-11-19)14-15-4-2-1-3-5-15/h1-9H,10-14H2
InChIKeyUUOARXCPUKAUIJ-UHFFFAOYSA-N
XLogP4.64
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.27
LogP ≤ 54.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride?
The IUPAC name of 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride (CID 87592673) is 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride.
What is the SMILES notation for 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride?
The canonical SMILES for 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride is O=C(Cl)C1(c2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride?
The InChIKey is UUOARXCPUKAUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2NO/c20-17-8-6-16(7-9-17)19(18(21)23)10-12-22(13-11-19)14-15-4-2-1-3-5-15/h1-9H,10-14H2.
What are the key properties of 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride?
1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride has a molecular weight of 348.27 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(4-chlorophenyl)piperidine-4-carbonyl chloride is sourced from PubChem (CID 87592673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).