C21H25Cl2NO — CID 87591877
1-benzyl-4-(3,4-dimethylphenyl)piperidine-4-carbonyl chloride;hydrochloride (PubChem CID 87591877) has the molecular formula C21H25Cl2NO and a molecular weight of 378.34 g/mol. Its IUPAC name is 1-benzyl-4-(3,4-dimethylphenyl)piperidine-4-carbonyl chloride;hydrochloride.
| Compound Name | 1-benzyl-4-(3,4-dimethylphenyl)piperidine-4-carbonyl chloride;hydrochloride |
|---|---|
| PubChem CID | 87591877 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-benzyl-4-(3,4-dimethylphenyl)piperidine-4-carbonyl chloride;hydrochloride |
| SMILES | Cc1ccc(C2(C(=O)Cl)CCN(Cc3ccccc3)CC2)cc1C.Cl |
| InChI | InChI=1S/C21H24ClNO.ClH/c1-16-8-9-19(14-17(16)2)21(20(22)24)10-12-23(13-11-21)15-18-6-4-3-5-7-18;/h3-9,14H,10-13,15H2,1-2H3;1H |
| InChIKey | RMWWEZXNXGNSQH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|