C20H22FNO3 — CID 90910968
1-benzyl-4-(3-fluoro-4-methylphenyl)-4-hydroxypiperidine-3-carboxylic acid (PubChem CID 90910968) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-benzyl-4-(3-fluoro-4-methylphenyl)-4-hydroxypiperidine-3-carboxylic acid.
| Compound Name | 1-benzyl-4-(3-fluoro-4-methylphenyl)-4-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 90910968 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-benzyl-4-(3-fluoro-4-methylphenyl)-4-hydroxypiperidine-3-carboxylic acid |
| SMILES | Cc1ccc(C2(O)CCN(Cc3ccccc3)CC2C(=O)O)cc1F |
| InChI | InChI=1S/C20H22FNO3/c1-14-7-8-16(11-18(14)21)20(25)9-10-22(13-17(20)19(23)24)12-15-5-3-2-4-6-15/h2-8,11,17,25H,9-10,12-13H2,1H3,(H,23,24) |
| InChIKey | PAGDIWWWQZAOER-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |