C20H25NO — CID 19095619
1-benzyl-3-methyl-4-(3-methylphenyl)piperidin-4-ol (PubChem CID 19095619) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-benzyl-3-methyl-4-(3-methylphenyl)piperidin-4-ol.
| Compound Name | 1-benzyl-3-methyl-4-(3-methylphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 19095619 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-benzyl-3-methyl-4-(3-methylphenyl)piperidin-4-ol |
| SMILES | Cc1cccc(C2(O)CCN(Cc3ccccc3)CC2C)c1 |
| InChI | InChI=1S/C20H25NO/c1-16-7-6-10-19(13-16)20(22)11-12-21(14-17(20)2)15-18-8-4-3-5-9-18/h3-10,13,17,22H,11-12,14-15H2,1-2H3 |
| InChIKey | SSGDWBIUMLAHAP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |