C20H21FN2 — CID 70261851
1-benzyl-4-(4-fluoro-3-methylphenyl)piperidine-4-carbonitrile (PubChem CID 70261851) has the molecular formula C20H21FN2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-benzyl-4-(4-fluoro-3-methylphenyl)piperidine-4-carbonitrile.
| Compound Name | 1-benzyl-4-(4-fluoro-3-methylphenyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 70261851 |
| Molecular Formula | C20H21FN2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-benzyl-4-(4-fluoro-3-methylphenyl)piperidine-4-carbonitrile |
| SMILES | Cc1cc(C2(C#N)CCN(Cc3ccccc3)CC2)ccc1F |
| InChI | InChI=1S/C20H21FN2/c1-16-13-18(7-8-19(16)21)20(15-22)9-11-23(12-10-20)14-17-5-3-2-4-6-17/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | XMBJAOVDTLKKRG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |