C21H23ClN2O — CID 131908217
1-[(3-chloro-4-ethoxyphenyl)methyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 131908217) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxyphenyl)methyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[(3-chloro-4-ethoxyphenyl)methyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 131908217 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(3-chloro-4-ethoxyphenyl)methyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | CCOc1ccc(CN2CCC(C#N)(c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C21H23ClN2O/c1-2-25-20-9-8-17(14-19(20)22)15-24-12-10-21(16-23,11-13-24)18-6-4-3-5-7-18/h3-9,14H,2,10-13,15H2,1H3 |
| InChIKey | DPHZERBWHBVOMD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |