C22H25N3O2 — CID 11610247
2-amino-3-[3-[(4-cyano-4-phenylpiperidin-1-yl)methyl]phenyl]propanoic acid (PubChem CID 11610247) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-amino-3-[3-[(4-cyano-4-phenylpiperidin-1-yl)methyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-[(4-cyano-4-phenylpiperidin-1-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11610247 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-amino-3-[3-[(4-cyano-4-phenylpiperidin-1-yl)methyl]phenyl]propanoic acid |
| SMILES | N#CC1(c2ccccc2)CCN(Cc2cccc(CC(N)C(=O)O)c2)CC1 |
| InChI | InChI=1S/C22H25N3O2/c23-16-22(19-7-2-1-3-8-19)9-11-25(12-10-22)15-18-6-4-5-17(13-18)14-20(24)21(26)27/h1-8,13,20H,9-12,14-15,24H2,(H,26,27) |
| InChIKey | NHTQRFPZZQRJSF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |