C28H30FN3O — CID 55537878
N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 55537878) has the molecular formula C28H30FN3O and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 55537878 |
| Molecular Formula | C28H30FN3O |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C28H30FN3O/c29-24-9-7-23(8-10-24)28(15-4-16-28)27(33)30-25-11-13-26(14-12-25)32-19-17-31(18-20-32)21-22-5-2-1-3-6-22/h1-3,5-14H,4,15-21H2,(H,30,33) |
| InChIKey | QJJBAQTZNCKFMC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|