C37H33F9N2O2S — CID 144882192
1-benzyl-4-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]piperazine (PubChem CID 144882192) has the molecular formula C37H33F9N2O2S and a molecular weight of 740.73 g/mol. Its IUPAC name is 1-benzyl-4-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]piperazine.
| Compound Name | 1-benzyl-4-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]piperazine |
|---|---|
| PubChem CID | 144882192 |
| Molecular Formula | C37H33F9N2O2S |
| Molecular Weight | 740.73 g/mol |
| Exact Mass | 740.21 |
| IUPAC Name | 1-benzyl-4-[3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylcyclobutyl]piperazine |
| SMILES | O=S(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CC(N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C37H33F9N2O2S/c38-28-13-15-30(16-14-28)51(49)34(21-29(22-34)48-19-17-47(18-20-48)23-25-5-2-1-3-6-25)26-9-11-27(12-10-26)35(36(41,42)43,37(44,45)46)50-24-31-32(39)7-4-8-33(31)40/h1-16,29H,17-24H2 |
| InChIKey | NSSHPQWMEIDKLF-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.73 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |