C33H25BrF9NO3S — CID 118208075
1-benzyl-3-(3-bromo-4-fluorophenyl)sulfonyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine (PubChem CID 118208075) has the molecular formula C33H25BrF9NO3S and a molecular weight of 766.52 g/mol. Its IUPAC name is 1-benzyl-3-(3-bromo-4-fluorophenyl)sulfonyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine.
| Compound Name | 1-benzyl-3-(3-bromo-4-fluorophenyl)sulfonyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 118208075 |
| Molecular Formula | C33H25BrF9NO3S |
| Molecular Weight | 766.52 g/mol |
| Exact Mass | 765.06 |
| IUPAC Name | 1-benzyl-3-(3-bromo-4-fluorophenyl)sulfonyl-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccc(F)c(Br)c1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C33H25BrF9NO3S/c34-26-17-24(13-14-29(26)37)48(45,46)30(15-16-44(20-30)18-21-5-2-1-3-6-21)22-9-11-23(12-10-22)31(32(38,39)40,33(41,42)43)47-19-25-27(35)7-4-8-28(25)36/h1-14,17H,15-16,18-20H2 |
| InChIKey | ONKFMPZJWDAIOX-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.52 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |