C32H26F9N3O3S — CID 134373669
1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]pyrrolidine-3-carbonitrile (PubChem CID 134373669) has the molecular formula C32H26F9N3O3S and a molecular weight of 703.63 g/mol. Its IUPAC name is 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]pyrrolidine-3-carbonitrile.
| Compound Name | 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 134373669 |
| Molecular Formula | C32H26F9N3O3S |
| Molecular Weight | 703.63 g/mol |
| Exact Mass | 703.16 |
| IUPAC Name | 1-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]pyrrolidine-3-carbonitrile |
| SMILES | N#CC1CCN(C(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)c3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C32H26F9N3O3S/c33-23-8-10-24(11-9-23)48(46)29(13-15-44(19-29)28(45)43-14-12-20(16-42)17-43)21-4-6-22(7-5-21)30(31(36,37)38,32(39,40)41)47-18-25-26(34)2-1-3-27(25)35/h1-11,20H,12-15,17-19H2/t20?,29-,48?/m0/s1 |
| InChIKey | DSIKGRPODUHWOM-HBHKUWBTSA-N |
| XLogP | 7.31 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |