C16H21N3S — CID 61331116
1-benzyl-N-methyl-4-(1,3-thiazol-2-yl)piperidin-4-amine (PubChem CID 61331116) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-benzyl-N-methyl-4-(1,3-thiazol-2-yl)piperidin-4-amine.
| Compound Name | 1-benzyl-N-methyl-4-(1,3-thiazol-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 61331116 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-benzyl-N-methyl-4-(1,3-thiazol-2-yl)piperidin-4-amine |
| SMILES | CNC1(c2nccs2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N3S/c1-17-16(15-18-9-12-20-15)7-10-19(11-8-16)13-14-5-3-2-4-6-14/h2-6,9,12,17H,7-8,10-11,13H2,1H3 |
| InChIKey | XWCMGTABJMLJIZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |