C17H30N2S — CID 63405296
N-ethyl-1-(1,3-thiazol-2-yl)cyclododecan-1-amine (PubChem CID 63405296) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is N-ethyl-1-(1,3-thiazol-2-yl)cyclododecan-1-amine.
| Compound Name | N-ethyl-1-(1,3-thiazol-2-yl)cyclododecan-1-amine |
|---|---|
| PubChem CID | 63405296 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-ethyl-1-(1,3-thiazol-2-yl)cyclododecan-1-amine |
| SMILES | CCNC1(c2nccs2)CCCCCCCCCCC1 |
| InChI | InChI=1S/C17H30N2S/c1-2-19-17(16-18-14-15-20-16)12-10-8-6-4-3-5-7-9-11-13-17/h14-15,19H,2-13H2,1H3 |
| InChIKey | ZOZIWRZHLVWBLM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |