C15H26N2S — CID 65086079
4-ethyl-N-propyl-1-(1,3-thiazol-2-yl)cycloheptan-1-amine (PubChem CID 65086079) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 4-ethyl-N-propyl-1-(1,3-thiazol-2-yl)cycloheptan-1-amine.
| Compound Name | 4-ethyl-N-propyl-1-(1,3-thiazol-2-yl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 65086079 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-ethyl-N-propyl-1-(1,3-thiazol-2-yl)cycloheptan-1-amine |
| SMILES | CCCNC1(c2nccs2)CCCC(CC)CC1 |
| InChI | InChI=1S/C15H26N2S/c1-3-10-17-15(14-16-11-12-18-14)8-5-6-13(4-2)7-9-15/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | LIFNCKGFDGUAAD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |