C11H18N2S2 — CID 79949785
5-methyl-N-propyl-3-(1,3-thiazol-2-yl)thiolan-3-amine (PubChem CID 79949785) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 5-methyl-N-propyl-3-(1,3-thiazol-2-yl)thiolan-3-amine.
| Compound Name | 5-methyl-N-propyl-3-(1,3-thiazol-2-yl)thiolan-3-amine |
|---|---|
| PubChem CID | 79949785 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 5-methyl-N-propyl-3-(1,3-thiazol-2-yl)thiolan-3-amine |
| SMILES | CCCNC1(c2nccs2)CSC(C)C1 |
| InChI | InChI=1S/C11H18N2S2/c1-3-4-13-11(7-9(2)15-8-11)10-12-5-6-14-10/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | VWZZUVYALVWDAX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |