C12H19NOS — CID 116782694
2-(1-ethoxycycloheptyl)-1,3-thiazole (PubChem CID 116782694) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(1-ethoxycycloheptyl)-1,3-thiazole.
| Compound Name | 2-(1-ethoxycycloheptyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116782694 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(1-ethoxycycloheptyl)-1,3-thiazole |
| SMILES | CCOC1(c2nccs2)CCCCCC1 |
| InChI | InChI=1S/C12H19NOS/c1-2-14-12(11-13-9-10-15-11)7-5-3-4-6-8-12/h9-10H,2-8H2,1H3 |
| InChIKey | MLYHVMLYOODXNW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |