C12H18N2S — CID 61334064
N-cyclopropyl-1-(1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 61334064) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N-cyclopropyl-1-(1,3-thiazol-2-yl)cyclohexan-1-amine.
| Compound Name | N-cyclopropyl-1-(1,3-thiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 61334064 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-cyclopropyl-1-(1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | c1csc(C2(NC3CC3)CCCCC2)n1 |
| InChI | InChI=1S/C12H18N2S/c1-2-6-12(7-3-1,14-10-4-5-10)11-13-8-9-15-11/h8-10,14H,1-7H2 |
| InChIKey | NFDDUWDAWGHNLV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |