C13H21N3OS — CID 119890159
2-amino-N-[1-(1,3-thiazol-2-yl)cyclopentyl]pentanamide (PubChem CID 119890159) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-amino-N-[1-(1,3-thiazol-2-yl)cyclopentyl]pentanamide.
| Compound Name | 2-amino-N-[1-(1,3-thiazol-2-yl)cyclopentyl]pentanamide |
|---|---|
| PubChem CID | 119890159 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-amino-N-[1-(1,3-thiazol-2-yl)cyclopentyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC1(c2nccs2)CCCC1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-5-10(14)11(17)16-13(6-3-4-7-13)12-15-8-9-18-12/h8-10H,2-7,14H2,1H3,(H,16,17) |
| InChIKey | AGNCLHPRZWIYIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |