C12H17N3O2S — CID 26469951
(5S)-5-(5-aminopentyl)-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 26469951) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is (5S)-5-(5-aminopentyl)-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(5-aminopentyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26469951 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (5S)-5-(5-aminopentyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | NCCCCC[C@]1(c2cccs2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H17N3O2S/c13-7-3-1-2-6-12(9-5-4-8-18-9)10(16)14-11(17)15-12/h4-5,8H,1-3,6-7,13H2,(H2,14,15,16,17)/t12-/m1/s1 |
| InChIKey | QVTJQZKJIRQSOP-GFCCVEGCSA-N |
| XLogP | 1.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|