C8H11N3OS — CID 23830026
5-(thiophen-2-ylmethyl)-1,3,5-triazinan-2-one (PubChem CID 23830026) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-(thiophen-2-ylmethyl)-1,3,5-triazinan-2-one.
| Compound Name | 5-(thiophen-2-ylmethyl)-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 23830026 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-(thiophen-2-ylmethyl)-1,3,5-triazinan-2-one |
| SMILES | O=C1NCN(Cc2cccs2)CN1 |
| InChI | InChI=1S/C8H11N3OS/c12-8-9-5-11(6-10-8)4-7-2-1-3-13-7/h1-3H,4-6H2,(H2,9,10,12) |
| InChIKey | LAVQKFPVDLFYMS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |