C13H15ClN4OS — CID 166385574
5-chloro-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-1H-pyrazin-2-one (PubChem CID 166385574) has the molecular formula C13H15ClN4OS and a molecular weight of 310.81 g/mol. Its IUPAC name is 5-chloro-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-1H-pyrazin-2-one.
| Compound Name | 5-chloro-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 166385574 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-chloro-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]-1H-pyrazin-2-one |
| SMILES | O=c1[nH]cc(Cl)nc1N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C13H15ClN4OS/c14-11-8-15-13(19)12(16-11)18-5-3-17(4-6-18)9-10-2-1-7-20-10/h1-2,7-8H,3-6,9H2,(H,15,19) |
| InChIKey | KRDMGMODXJLLSB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |