C14H17BrN4OS — CID 133302980
4-bromo-2-methyl-5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 133302980) has the molecular formula C14H17BrN4OS and a molecular weight of 369.29 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133302980 |
| Molecular Formula | C14H17BrN4OS |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 4-bromo-2-methyl-5-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(Cc3cccs3)CC2)c(Br)c1=O |
| InChI | InChI=1S/C14H17BrN4OS/c1-17-14(20)13(15)12(9-16-17)19-6-4-18(5-7-19)10-11-3-2-8-21-11/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | PYPOZMRAACGOGV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |