C15H18N4O3S — CID 19623779
1-methyl-5-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid (PubChem CID 19623779) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-methyl-5-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19623779 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-methyl-5-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]pyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1C(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H18N4O3S/c1-17-13(12(9-16-17)15(21)22)14(20)19-6-4-18(5-7-19)10-11-3-2-8-23-11/h2-3,8-9H,4-7,10H2,1H3,(H,21,22) |
| InChIKey | XXUWTZZRLWNDME-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |