C19H21BrN2OS — CID 134026118
[1-(4-bromophenyl)cyclopropyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 134026118) has the molecular formula C19H21BrN2OS and a molecular weight of 405.36 g/mol. Its IUPAC name is [1-(4-bromophenyl)cyclopropyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-bromophenyl)cyclopropyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134026118 |
| Molecular Formula | C19H21BrN2OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [1-(4-bromophenyl)cyclopropyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(Cc2cccs2)CC1)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H21BrN2OS/c20-16-5-3-15(4-6-16)19(7-8-19)18(23)22-11-9-21(10-12-22)14-17-2-1-13-24-17/h1-6,13H,7-12,14H2 |
| InChIKey | FUNJGNVJGZLXRT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |